Ladostigil
3-[(Prop-2-yn-1-yl)amino]-2,3-dihydro-1H-inden-5-yl ethyl(methyl)carbamate
 12038 C16H20N2O2 272.342
 InChI=1S/C16H20N2O2/c1-4-10-17-15-9-7-12-6-8-13(11-14(12)15)20-16(19)18(3)5-2/h1,6,8,11,15,17H,5,7,9-10H2,2-3H3
 LHXOCOHMBFOVJS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C#CCNC1CCc2c1cc(cc2)OC(=O)N(CC)C