2-Ethoxy-α-Ethyl-N-methylphenethylamine
1-(2-Ethoxyphenyl)-N-methylbutan-2-amine
 1203  C13H21NO  207.312
 InChI=1S/C13H21NO/c1-4-12(14-3)10-11-8-6-7-9-13(11)15-5-2/h6-9,12,14H,4-5,10H2,1-3H3
 HXELIVOLKBYPEM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1ccccc1CC(NC)CC