N,N-Me-5,8-ADT
5,8-Dimethoxy-N,N-dimethyl-1,2,3,4-tetrahydronaphthalen-2-amine
 1202 C14H21NO2 235.322
 InChI=1S/C14H21NO2/c1-15(2)10-5-6-11-12(9-10)14(17-4)8-7-13(11)16-3/h7-8,10H,5-6,9H2,1-4H3
 GNSMSAGJMPLOQA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc(c2c1CC(CC2)N(C)C)OC