N-Me-5,8-ADT
5,8-Dimethoxy-N-methyl-1,2,3,4-tetrahydronaphthalen-2-amine
 1201 C13H19NO2 221.295
 InChI=1S/C13H19NO2/c1-14-9-4-5-10-11(8-9)13(16-3)7-6-12(10)15-2/h6-7,9,14H,4-5,8H2,1-3H3
 GIPVFDIXAOJKFQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC1CCc2c(C1)c(OC)ccc2OC