1-(5-Phenylpentyl)piperidine
 12004 C16H25N 231.376
 InChI=1S/C16H25N/c1-4-10-16(11-5-1)12-6-2-7-13-17-14-8-3-9-15-17/h1,4-5,10-11H,2-3,6-9,12-15H2
 MRACOXALPXCQLZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C1CCN(CC1)CCCCCc1ccccc1