1-(5-Phenylpentyl)pyrrolidine
 12003 C15H23N 217.35
 InChI=1S/C15H23N/c1-3-9-15(10-4-1)11-5-2-6-12-16-13-7-8-14-16/h1,3-4,9-10H,2,5-8,11-14H2
 MMRLVNIMSBPBEB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C(CCc1ccccc1)CCN1CCCC1