β-Me-NBCN
2-{[(2-Phenylpropyl)amino]methyl}benzonitrile
 1170  C17H18N2  250.338
 InChI=1S/C17H18N2/c1-14(15-7-3-2-4-8-15)12-19-13-17-10-6-5-9-16(17)11-18/h2-10,14,19H,12-13H2,1H3
 AUILUGVBDWHSCG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 N#Cc1ccccc1CNCC(c1ccccc1)C