β-Me-NBpCl
N-[(4-Chlorophenyl)methyl]-2-phenylpropan-1-amine
 1168  C16H18ClN  259.774
 InChI=1S/C16H18ClN/c1-13(15-5-3-2-4-6-15)11-18-12-14-7-9-16(17)10-8-14/h2-10,13,18H,11-12H2,1H3
 AZXKEHQOEMVIQJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 Clc1ccc(cc1)CNCC(c1ccccc1)C