β-Me-NBOMe
N-[(2-Methoxyphenyl)methyl]-2-phenylpropan-1-amine
 1167  C17H21NO  255.355
 InChI=1S/C17H21NO/c1-14(15-8-4-3-5-9-15)12-18-13-16-10-6-7-11-17(16)19-2/h3-11,14,18H,12-13H2,1-2H3
 DPGWXSRIXDROHQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccccc1CNCC(c1ccccc1)C