BENZYL-4CN-BINACA
N-Benzyl-1-(4-cyanobutyl)-1H-indazole-3-carboxamide
 11371  C20H20N4O  332.399
 Cannabinoid
 InChI=1S/C20H20N4O/c21-13-7-2-8-14-24-18-12-6-5-11-17(18)19(23-24)20(25)22-15-16-9-3-1-4-10-16/h1,3-6,9-12H,2,7-8,14-15H2,(H,22,25)
 JISDUTVCVJSDFN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 N#CCCCCn1nc(c2c1cccc2)C(=O)NCc1ccccc1