25B-NB3OH
3-({[2-(4-Bromo-2,5-dimethoxyphenyl)ethyl]amino}methyl)phenol
 1119  C17H20BrNO3  366.25
 InChI=1S/C17H20BrNO3/c1-21-16-10-15(18)17(22-2)9-13(16)6-7-19-11-12-4-3-5-14(20)8-12/h3-5,8-10,19-20H,6-7,11H2,1-2H3
 MZWUFGTUXRBVNC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(Br)c(cc1CCNCc1cccc(c1)O)OC