N,N-Dimethyl-2-phenylpropan-1-amine
 1117 C11H17N 163.259
 InChI=1S/C11H17N/c1-10(9-12(2)3)11-7-5-4-6-8-11/h4-8,10H,9H2,1-3H3
 JFNWQFWYAAPODB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(c1ccccc1)CN(C)C