2-Ethoxy-β-ethyl-β-nitrostyrene
1-Ethoxy-2-[(1E)-2-nitrobut-1-en-1-yl]benzene
 11163  C12H15NO3  221.252
 InChI=1S/C12H15NO3/c1-3-11(13(14)15)9-10-7-5-6-8-12(10)16-4-2/h5-9H,3-4H2,1-2H3/b11-9+
 CBDCFHVNJFGFCH-PKNBQFBNSA-N This stereoisomer Any stereoisomer
 CCOc1ccccc1/C=C(/N(=O)=O)\CC