3-Methoxy-β-ethyl-β-nitrostyrene
1-Methoxy-3-[(1E)-2-nitrobut-1-en-1-yl]benzene
 11162  C11H13NO3  207.226
 InChI=1S/C11H13NO3/c1-3-10(12(13)14)7-9-5-4-6-11(8-9)15-2/h4-8H,3H2,1-2H3/b10-7+
 UHGZCDUVFQSIHC-JXMROGBWSA-N This stereoisomer Any stereoisomer
 CC/C(=C\c1cccc(c1)OC)/N(=O)=O