2-Methoxy-β-ethyl-β-nitrostyrene
1-Methoxy-2-[(1E)-2-nitrobut-1-en-1-yl]benzene
 11161  C11H13NO3  207.226
 InChI=1S/C11H13NO3/c1-3-10(12(13)14)8-9-6-4-5-7-11(9)15-2/h4-8H,3H2,1-2H3/b10-8+
 JAIJAHQUWZCSEK-CSKARUKUSA-N This stereoisomer Any stereoisomer
 CC/C(=C\c1ccccc1OC)/N(=O)=O