2-BBAL
2-Butoxybenzaldehyde
 11128  C11H14O2  178.228
 InChI=1S/C11H14O2/c1-2-3-8-13-11-7-5-4-6-10(11)9-12/h4-7,9H,2-3,8H2,1H3
 FSMCOBJDZVRWIZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCOc1ccccc1C=O