2-Ethoxy-4-hydroxybenzaldehyde
 11101  C9H10O3  166.174
 InChI=1S/C9H10O3/c1-2-12-9-5-8(11)4-3-7(9)6-10/h3-6,11H,2H2,1H3
 GQENNFHUCSKOPN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1cc(O)ccc1C=O