4-Methoxy-2-[(prop-2-en-1-yl)oxy]benzaldehyde
 11099  C11H12O3  192.211
 InChI=1S/C11H12O3/c1-3-6-14-11-7-10(13-2)5-4-9(11)8-12/h3-5,7-8H,1,6H2,2H3
 OKKOLCSGONNEPL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(OCC=C)c(cc1)C=O