4-BnO-MET
2-[4-(Benzyloxy)-1H-indol-3-yl]-N-ethyl-N-methylethan-1-amine
 11073  C20H24N2O  308.417
 InChI=1S/C20H24N2O/c1-3-22(2)13-12-17-14-21-18-10-7-11-19(20(17)18)23-15-16-8-5-4-6-9-16/h4-11,14,21H,3,12-13,15H2,1-2H3
 OHGZJUNXHYWPKS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCN(CCc1c[nH]c2c1c(ccc2)OCc1ccccc1)C