α-Methyl-DET
N,N-Diethyl-1-(1H-indol-3-yl)propan-2-amine
 11072  C15H22N2  230.349
 InChI=1S/C15H22N2/c1-4-17(5-2)12(3)10-13-11-16-15-9-7-6-8-14(13)15/h6-9,11-12,16H,4-5,10H2,1-3H3
 YMFPRPQKQINYPV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCN(C(Cc1c[nH]c2c1cccc2)C)CC