1-Methyl-DET
N,N-Diethyl-2-(1-methyl-1H-indol-3-yl)ethan-1-amine
 11071  C15H22N2  230.349
 InChI=1S/C15H22N2/c1-4-17(5-2)11-10-13-12-16(3)15-9-7-6-8-14(13)15/h6-9,12H,4-5,10-11H2,1-3H3
 XEZGKHOCSAELET-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCN(CCc1cn(c2c1cccc2)C)CC