Valerylfentanyl
N-Phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]pentanamide
 1107 C24H32N2O 364.524
 Fentanyl
 InChI=1S/C24H32N2O/c1-2-3-14-24(27)26(22-12-8-5-9-13-22)23-16-19-25(20-17-23)18-15-21-10-6-4-7-11-21/h4-13,23H,2-3,14-20H2,1H3
 VCCPXHWAJYWQMR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCC(=O)N(c1ccccc1)C1CCN(CC1)CCc1ccccc1