2-DM-2C-B
2-(2-Aminoethyl)-5-bromo-4-methoxyphenol
 1099  C9H12BrNO2  246.101
 InChI=1S/C9H12BrNO2/c1-13-9-4-6(2-3-11)8(12)5-7(9)10/h4-5,12H,2-3,11H2,1H3
 LTIUWTXENMGCDK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(cc1O)Br