N-(Prop-2-yn-1-yl)-2,3-dihydro-1H-inden-2-amine
 10876 C12H13N 171.238
 InChI=1S/C12H13N/c1-2-7-13-12-8-10-5-3-4-6-11(10)9-12/h1,3-6,12-13H,7-9H2
 VATJAIMUDJKBIN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C#CCNC1Cc2c(C1)cccc2