2-(3,4,5-Trimethoxyphenyl)ethan-1-ol
 10871 C11H16O4 212.242
 InChI=1S/C11H16O4/c1-13-9-6-8(4-5-12)7-10(14-2)11(9)15-3/h6-7,12H,4-5H2,1-3H3
 CMHJWVUNNCFNOH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 OCCc1cc(OC)c(c(c1)OC)OC