G-130
5,5-Dimethyl-2-phenylmorpholine
 10867 C12H17NO 191.269
 InChI=1S/C12H17NO/c1-12(2)9-14-11(8-13-12)10-6-4-3-5-7-10/h3-7,11,13H,8-9H2,1-2H3
 KJUOROGOOZJYAI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC1(C)NCC(OC1)c1ccccc1