1-(2-Phenethyl)piperazine
1-(2-Phenylethyl)piperazine
 10865  C12H18N2  190.285
 InChI=1S/C12H18N2/c1-2-4-12(5-3-1)6-9-14-10-7-13-8-11-14/h1-5,13H,6-11H2
 LKUAPSRIYZLAAO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 N1CCN(CC1)CCc1ccccc1