Phacetoperane
Phenyl(piperidin-2-yl)methyl acetate
 10862 C14H19NO2 233.306
 InChI=1S/C14H19NO2/c1-11(16)17-14(12-7-3-2-4-8-12)13-9-5-6-10-15-13/h2-4,7-8,13-15H,5-6,9-10H2,1H3
 BKPLVPRTTWIDNL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(=O)OC(c1ccccc1)C1CCCCN1