3-Phenylazetidin-3-ol
 10844 C9H11NO 149.19
 InChI=1S/C9H11NO/c11-9(6-10-7-9)8-4-2-1-3-5-8/h1-5,10-11H,6-7H2
 BCCJGJCXMIOABO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 OC1(CNC1)c1ccccc1