2-Phenyl-N-(propan-2-yl)cyclohexan-1-amine
 10835 C15H23N 217.35
 InChI=1S/C15H23N/c1-12(2)16-15-11-7-6-10-14(15)13-8-4-3-5-9-13/h3-5,8-9,12,14-16H,6-7,10-11H2,1-2H3
 RGRISJFOBIMSBP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(NC1CCCCC1c1ccccc1)C