3-Phenylpentan-2-amine
 10793 C11H17N 163.259
 InChI=1S/C11H17N/c1-3-11(9(2)12)10-7-5-4-6-8-10/h4-9,11H,3,12H2,1-2H3
 WRGJOKNIPZFMKU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(c1ccccc1)C(N)C