2-Cyclohexyl-N-methyl-2-phenylethan-1-amine
 10787 C15H23N 217.35
 InChI=1S/C15H23N/c1-16-12-15(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2,4-5,8-9,14-16H,3,6-7,10-12H2,1H3
 CKCPDYFJMZGBNG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCC(c1ccccc1)C1CCCCC1