N-Methyl-2-phenylbutan-1-amine
 10783 C11H17N 163.259
 InChI=1S/C11H17N/c1-3-10(9-12-2)11-7-5-4-6-8-11/h4-8,10,12H,3,9H2,1-2H3
 XLBPZPVJGDFUMN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCC(c1ccccc1)CC