2-I-TMA
1-(2-Iodo-3,4,5-trimethoxyphenyl)propan-2-amine
 1078  C12H18INO3  351.181
 InChI=1S/C12H18INO3/c1-7(14)5-8-6-9(15-2)11(16-3)12(17-4)10(8)13/h6-7H,5,14H2,1-4H3
 BIOGMPHWEYYWAN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(CC(N)C)c(c(c1OC)OC)I