1-Phenylpentan-2-amine
 10763 C11H17N 163.259
 InChI=1S/C11H17N/c1-2-6-11(12)9-10-7-4-3-5-8-10/h3-5,7-8,11H,2,6,9,12H2,1H3
 VXGQDFOHLMAZIV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCC(Cc1ccccc1)N