5-I-TMA-5
1-(3-Iodo-2,5,6-trimethoxyphenyl)propan-2-amine
 1076  C12H18INO3  351.181
 InChI=1S/C12H18INO3/c1-7(14)5-8-11(16-3)9(13)6-10(15-2)12(8)17-4/h6-7H,5,14H2,1-4H3
 WKGNLABYSPDJEO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1c(OC)cc(c(c1CC(N)C)OC)I