2-Phenoxycyclopropan-1-amine
 10745 C9H11NO 149.19
 InChI=1S/C9H11NO/c10-8-6-9(8)11-7-4-2-1-3-5-7/h1-5,8-9H,6,10H2
 LWTVCQHYQVDFLN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NC1CC1Oc1ccccc1