(1-Phenylpropan-2-yl)cyanamide
 10739 C10H12N2 160.216
 InChI=1S/C10H12N2/c1-9(12-8-11)7-10-5-3-2-4-6-10/h2-6,9,12H,7H2,1H3
 FWMVMAKOXMAXNA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccccc1)NC#N