Methyl(2-phenylethyl)cyanamide
 10738 C10H12N2 160.216
 InChI=1S/C10H12N2/c1-12(9-11)8-7-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3
 RXLVEAXQAPBGFG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(C#N)CCc1ccccc1