2-Methyl-N-(2-phenylethyl)prop-2-enamide
 10733  C12H15NO  189.254
 InChI=1S/C12H15NO/c1-10(2)12(14)13-9-8-11-6-4-3-5-7-11/h3-7H,1,8-9H2,2H3,(H,13,14)
 GTAFMQMHTPUJMR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(=C)C(=O)NCCc1ccccc1