Isopropylmethamphetamine
N-Methyl-1-phenyl-N-(propan-2-yl)propan-2-amine
 10699  C13H21N  191.313
 InChI=1S/C13H21N/c1-11(2)14(4)12(3)10-13-8-6-5-7-9-13/h5-9,11-12H,10H2,1-4H3
 YNAARHBVVQFFKN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(N(C(C)C)C)Cc1ccccc1