5-I-TMA-3
1-(5-Iodo-2,3,4-trimethoxyphenyl)propan-2-amine
 1069  C12H18INO3  351.181
 InChI=1S/C12H18INO3/c1-7(14)5-8-6-9(13)11(16-3)12(17-4)10(8)15-2/h6-7H,5,14H2,1-4H3
 LPGGQTQLVVUMKA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1c(CC(N)C)cc(c(c1OC)OC)I