N-(1-Phenylpropan-2-yl)cyclohexanamine
 10665 C15H23N 217.35
 InChI=1S/C15H23N/c1-13(12-14-8-4-2-5-9-14)16-15-10-6-3-7-11-15/h2,4-5,8-9,13,15-16H,3,6-7,10-12H2,1H3
 YSCGHIJDKVTDSJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccccc1)NC1CCCCC1