N-(1-Phenylpropan-2-yl)cyclopentanamine
 10664 C14H21N 203.323
 InChI=1S/C14H21N/c1-12(15-14-9-5-6-10-14)11-13-7-3-2-4-8-13/h2-4,7-8,12,14-15H,5-6,9-11H2,1H3
 ZAOAQJWJEAOBEF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccccc1)NC1CCCC1