2-[Methyl(propan-2-yl)amino]-1-(4-nitrophenyl)ethan-1-ol
 10618  C12H18N2O3  238.283
 InChI=1S/C12H18N2O3/c1-9(2)13(3)8-12(15)10-4-6-11(7-5-10)14(16)17/h4-7,9,12,15H,8H2,1-3H3
 HGCIZPBBLXQLJX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 OC(c1ccc(cc1)N(=O)=O)CN(C(C)C)C