Isoxsuprine
4-{1-Hydroxy-2-[(1-phenoxypropan-2-yl)amino]propyl}phenol
 10616 C18H23NO3 301.38
 InChI=1S/C18H23NO3/c1-13(12-22-17-6-4-3-5-7-17)19-14(2)18(21)15-8-10-16(20)11-9-15/h3-11,13-14,18-21H,12H2,1-2H3
 BMUKKTUHUDJSNZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(NC(C(c1ccc(cc1)O)O)C)COc1ccccc1