Ritodrine
4-(1-Hydroxy-2-{[2-(4-hydroxyphenyl)ethyl]amino}propyl)phenol
 10615 C17H21NO3 287.354
 InChI=1S/C17H21NO3/c1-12(17(21)14-4-8-16(20)9-5-14)18-11-10-13-2-6-15(19)7-3-13/h2-9,12,17-21H,10-11H2,1H3
 IOVGROKTTNBUGK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 Oc1ccc(cc1)CCNC(C(c1ccc(cc1)O)O)C