1-(4-Chlorophenyl)-1-fluoropropan-2-amine
 10603  C9H11ClFN  187.642
 InChI=1S/C9H11ClFN/c1-6(12)9(11)7-2-4-8(10)5-3-7/h2-6,9H,12H2,1H3
 AMRUWXOHTFFJIA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 FC(c1ccc(cc1)Cl)C(N)C