4-Benzamidoamphetamine
N-[4-(2-Aminopropyl)phenyl]benzamide
 10601  C16H18N2O  254.327
 InChI=1S/C16H18N2O/c1-12(17)11-13-7-9-15(10-8-13)18-16(19)14-5-3-2-4-6-14/h2-10,12H,11,17H2,1H3,(H,18,19)
 MZVOWCPIOGNVDL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccc(cc1)NC(=O)c1ccccc1)N