4-(2-Aminocyclopropyl)-N,N-dimethylaniline
 10591  C11H16N2  176.258
 InChI=1S/C11H16N2/c1-13(2)9-5-3-8(4-6-9)10-7-11(10)12/h3-6,10-11H,7,12H2,1-2H3
 RFXSQJLTKLMDQG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NC1CC1c1ccc(cc1)N(C)C